C15H21Cl2N3O3S2 — CID 142627828
N-[2-(2,4-dichlorophenyl)-2-methoxyiminoethyl]-2-(methanesulfonamido)pentanethioamide (PubChem CID 142627828) has the molecular formula C15H21Cl2N3O3S2 and a molecular weight of 426.39 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)-2-methoxyiminoethyl]-2-(methanesulfonamido)pentanethioamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)-2-methoxyiminoethyl]-2-(methanesulfonamido)pentanethioamide |
|---|---|
| PubChem CID | 142627828 |
| Molecular Formula | C15H21Cl2N3O3S2 |
| Molecular Weight | 426.39 g/mol |
| Exact Mass | 425.04 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)-2-methoxyiminoethyl]-2-(methanesulfonamido)pentanethioamide |
| SMILES | CCCC(NS(C)(=O)=O)C(=S)NCC(=NOC)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H21Cl2N3O3S2/c1-4-5-13(20-25(3,21)22)15(24)18-9-14(19-23-2)11-7-6-10(16)8-12(11)17/h6-8,13,20H,4-5,9H2,1-3H3,(H,18,24) |
| InChIKey | AELNZUXVXBLSCT-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|