C14H19Cl2N3O5S — CID 142637549
2-[[(2E)-2-(2,4-dichlorophenyl)-2-methoxyiminoethyl]-methylsulfonylamino]-3-hydroxybutanamide (PubChem CID 142637549) has the molecular formula C14H19Cl2N3O5S and a molecular weight of 412.30 g/mol. Its IUPAC name is 2-[[(2E)-2-(2,4-dichlorophenyl)-2-methoxyiminoethyl]-methylsulfonylamino]-3-hydroxybutanamide.
| Compound Name | 2-[[(2E)-2-(2,4-dichlorophenyl)-2-methoxyiminoethyl]-methylsulfonylamino]-3-hydroxybutanamide |
|---|---|
| PubChem CID | 142637549 |
| Molecular Formula | C14H19Cl2N3O5S |
| Molecular Weight | 412.30 g/mol |
| Exact Mass | 411.04 |
| IUPAC Name | 2-[[(2E)-2-(2,4-dichlorophenyl)-2-methoxyiminoethyl]-methylsulfonylamino]-3-hydroxybutanamide |
| SMILES | CO/N=C(/CN(C(C(N)=O)C(C)O)S(C)(=O)=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H19Cl2N3O5S/c1-8(20)13(14(17)21)19(25(3,22)23)7-12(18-24-2)10-5-4-9(15)6-11(10)16/h4-6,8,13,20H,7H2,1-3H3,(H2,17,21)/b18-12- |
| InChIKey | XJDXPBOFUIXMDC-PDGQHHTCSA-N |
| XLogP | 0.84 |
| TPSA | 122.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.30 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|