C9H8O — CID 142677543
1-ethynylcyclohexa-2,4-diene-1-carbaldehyde (PubChem CID 142677543) has the molecular formula C9H8O and a molecular weight of 132.16 g/mol. Its IUPAC name is 1-ethynylcyclohexa-2,4-diene-1-carbaldehyde.
| Compound Name | 1-ethynylcyclohexa-2,4-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 142677543 |
| Molecular Formula | C9H8O |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.06 |
| IUPAC Name | 1-ethynylcyclohexa-2,4-diene-1-carbaldehyde |
| SMILES | C#CC1(C=O)C=CC=CC1 |
| InChI | InChI=1S/C9H8O/c1-2-9(8-10)6-4-3-5-7-9/h1,3-6,8H,7H2 |
| InChIKey | WWOABGMZQVDIPS-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|