C16H26N2O2 — CID 142700102
2-(diethylamino)ethyl 4-amino-2,3,5-trimethylbenzoate (PubChem CID 142700102) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 4-amino-2,3,5-trimethylbenzoate.
| Compound Name | 2-(diethylamino)ethyl 4-amino-2,3,5-trimethylbenzoate |
|---|---|
| PubChem CID | 142700102 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 2-(diethylamino)ethyl 4-amino-2,3,5-trimethylbenzoate |
| SMILES | CCN(CC)CCOC(=O)c1cc(C)c(N)c(C)c1C |
| InChI | InChI=1S/C16H26N2O2/c1-6-18(7-2)8-9-20-16(19)14-10-11(3)15(17)13(5)12(14)4/h10H,6-9,17H2,1-5H3 |
| InChIKey | XAQOGHQIDPLBCW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|