C26H25NO4 — CID 142713011
ethyl 1,2-dibenzyl-5-methoxy-3-oxoindole-2-carboxylate (PubChem CID 142713011) has the molecular formula C26H25NO4 and a molecular weight of 415.49 g/mol. Its IUPAC name is ethyl 1,2-dibenzyl-5-methoxy-3-oxoindole-2-carboxylate.
| Compound Name | ethyl 1,2-dibenzyl-5-methoxy-3-oxoindole-2-carboxylate |
|---|---|
| PubChem CID | 142713011 |
| Molecular Formula | C26H25NO4 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | ethyl 1,2-dibenzyl-5-methoxy-3-oxoindole-2-carboxylate |
| SMILES | CCOC(=O)C1(Cc2ccccc2)C(=O)c2cc(OC)ccc2N1Cc1ccccc1 |
| InChI | InChI=1S/C26H25NO4/c1-3-31-25(29)26(17-19-10-6-4-7-11-19)24(28)22-16-21(30-2)14-15-23(22)27(26)18-20-12-8-5-9-13-20/h4-16H,3,17-18H2,1-2H3 |
| InChIKey | CSWWXSAOKYHUJF-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|