C28H33NO5 — CID 11826697
ethyl (1S,3R,5S,6R,8R)-10-benzyl-5-[(3-methoxyphenyl)methyl]-3-methyl-9-oxo-11-oxa-10-azatricyclo[6.2.1.01,6]undecane-8-carboxylate (PubChem CID 11826697) has the molecular formula C28H33NO5 and a molecular weight of 463.57 g/mol. Its IUPAC name is ethyl (1S,3R,5S,6R,8R)-10-benzyl-5-[(3-methoxyphenyl)methyl]-3-methyl-9-oxo-11-oxa-10-azatricyclo[6.2.1.01,6]undecane-8-carboxylate.
| Compound Name | ethyl (1S,3R,5S,6R,8R)-10-benzyl-5-[(3-methoxyphenyl)methyl]-3-methyl-9-oxo-11-oxa-10-azatricyclo[6.2.1.01,6]undecane-8-carboxylate |
|---|---|
| PubChem CID | 11826697 |
| Molecular Formula | C28H33NO5 |
| Molecular Weight | 463.57 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | ethyl (1S,3R,5S,6R,8R)-10-benzyl-5-[(3-methoxyphenyl)methyl]-3-methyl-9-oxo-11-oxa-10-azatricyclo[6.2.1.01,6]undecane-8-carboxylate |
| SMILES | CCOC(=O)[C@]12C[C@@H]3[C@H](Cc4cccc(OC)c4)C[C@@H](C)C[C@@]3(O1)N(Cc1ccccc1)C2=O |
| InChI | InChI=1S/C28H33NO5/c1-4-33-26(31)27-17-24-22(14-21-11-8-12-23(15-21)32-3)13-19(2)16-28(24,34-27)29(25(27)30)18-20-9-6-5-7-10-20/h5-12,15,19,22,24H,4,13-14,16-18H2,1-3H3/t19-,22+,24-,27-,28+/m1/s1 |
| InChIKey | NIFLRCJLMRDKHB-ZIIWFXOUSA-N |
| XLogP | 4.36 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.57 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|