C35H37NO6S — CID 10531624
ethyl (1R,9S,10R,16R)-14-benzyl-5-methoxy-16-methyl-13-oxo-12-phenoxycarbothioyloxy-14-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-12-carboxylate (PubChem CID 10531624) has the molecular formula C35H37NO6S and a molecular weight of 599.75 g/mol. Its IUPAC name is ethyl (1R,9S,10R,16R)-14-benzyl-5-methoxy-16-methyl-13-oxo-12-phenoxycarbothioyloxy-14-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-12-carboxylate.
| Compound Name | ethyl (1R,9S,10R,16R)-14-benzyl-5-methoxy-16-methyl-13-oxo-12-phenoxycarbothioyloxy-14-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-12-carboxylate |
|---|---|
| PubChem CID | 10531624 |
| Molecular Formula | C35H37NO6S |
| Molecular Weight | 599.75 g/mol |
| Exact Mass | 599.23 |
| IUPAC Name | ethyl (1R,9S,10R,16R)-14-benzyl-5-methoxy-16-methyl-13-oxo-12-phenoxycarbothioyloxy-14-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-12-carboxylate |
| SMILES | CCOC(=O)C1(OC(=S)Oc2ccccc2)C[C@@H]2[C@@H]3Cc4cc(OC)ccc4[C@]2(C[C@H](C)C3)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C35H37NO6S/c1-4-40-32(38)35(42-33(43)41-27-13-9-6-10-14-27)21-30-25-17-23(2)20-34(30,29-16-15-28(39-3)19-26(29)18-25)36(31(35)37)22-24-11-7-5-8-12-24/h5-16,19,23,25,30H,4,17-18,20-22H2,1-3H3/t23-,25+,30-,34+,35?/m1/s1 |
| InChIKey | MYLAUPDHZJKPCN-LCTHUECTSA-N |
| XLogP | 6.22 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.75 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|