C22H36O7Si — CID 142724535
(7Z,13Z)-3-tri(propan-2-yl)silyloxy-1,5,11-trioxacyclohexadeca-7,13-diene-2,6,12-trione (PubChem CID 142724535) has the molecular formula C22H36O7Si and a molecular weight of 440.61 g/mol. Its IUPAC name is (7Z,13Z)-3-tri(propan-2-yl)silyloxy-1,5,11-trioxacyclohexadeca-7,13-diene-2,6,12-trione.
| Compound Name | (7Z,13Z)-3-tri(propan-2-yl)silyloxy-1,5,11-trioxacyclohexadeca-7,13-diene-2,6,12-trione |
|---|---|
| PubChem CID | 142724535 |
| Molecular Formula | C22H36O7Si |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | (7Z,13Z)-3-tri(propan-2-yl)silyloxy-1,5,11-trioxacyclohexadeca-7,13-diene-2,6,12-trione |
| SMILES | CC(C)[Si](OC1COC(=O)/C=C\CCOC(=O)/C=C\CCOC1=O)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H36O7Si/c1-16(2)30(17(3)4,18(5)6)29-19-15-28-21(24)12-7-9-13-26-20(23)11-8-10-14-27-22(19)25/h7-8,11-12,16-19H,9-10,13-15H2,1-6H3/b11-8-,12-7- |
| InChIKey | FHUORWZWVPJYGI-HONFXZPPSA-N |
| XLogP | 4.08 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|