C27H31ClN10O — CID 142729544
(E)-N-[(3R)-1-[5-chloro-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]pyrrolidin-3-yl]-2-cyano-3-(1-methylpyrazol-4-yl)prop-2-enamide (PubChem CID 142729544) has the molecular formula C27H31ClN10O and a molecular weight of 547.07 g/mol. Its IUPAC name is (E)-N-[(3R)-1-[5-chloro-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]pyrrolidin-3-yl]-2-cyano-3-(1-methylpyrazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-[(3R)-1-[5-chloro-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]pyrrolidin-3-yl]-2-cyano-3-(1-methylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 142729544 |
| Molecular Formula | C27H31ClN10O |
| Molecular Weight | 547.07 g/mol |
| Exact Mass | 546.24 |
| IUPAC Name | (E)-N-[(3R)-1-[5-chloro-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]pyrrolidin-3-yl]-2-cyano-3-(1-methylpyrazol-4-yl)prop-2-enamide |
| SMILES | CN1CCN(c2ccc(Nc3ncc(Cl)c(N4CC[C@@H](NC(=O)/C(C#N)=C/c5cnn(C)c5)C4)n3)cc2)CC1 |
| InChI | InChI=1S/C27H31ClN10O/c1-35-9-11-37(12-10-35)23-5-3-21(4-6-23)33-27-30-16-24(28)25(34-27)38-8-7-22(18-38)32-26(39)20(14-29)13-19-15-31-36(2)17-19/h3-6,13,15-17,22H,7-12,18H2,1-2H3,(H,32,39)(H,30,33,34)/b20-13+/t22-/m1/s1 |
| InChIKey | YKRCVUNKBYZJMY-WVWKGNOCSA-N |
| XLogP | 2.66 |
| TPSA | 118.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.07 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|