C25H34N8O4SSi — CID 142735198
N-methyl-4-[[2-[methyl(1H-pyrazol-4-ylsulfonyl)amino]phenyl]methylamino]-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,3-c]pyridine-3-carboxamide (PubChem CID 142735198) has the molecular formula C25H34N8O4SSi and a molecular weight of 570.75 g/mol. Its IUPAC name is N-methyl-4-[[2-[methyl(1H-pyrazol-4-ylsulfonyl)amino]phenyl]methylamino]-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,3-c]pyridine-3-carboxamide.
| Compound Name | N-methyl-4-[[2-[methyl(1H-pyrazol-4-ylsulfonyl)amino]phenyl]methylamino]-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,3-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 142735198 |
| Molecular Formula | C25H34N8O4SSi |
| Molecular Weight | 570.75 g/mol |
| Exact Mass | 570.22 |
| IUPAC Name | N-methyl-4-[[2-[methyl(1H-pyrazol-4-ylsulfonyl)amino]phenyl]methylamino]-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,3-c]pyridine-3-carboxamide |
| SMILES | CNC(=O)c1nn(COCC[Si](C)(C)C)c2ccnc(NCc3ccccc3N(C)S(=O)(=O)c3cn[nH]c3)c12 |
| InChI | InChI=1S/C25H34N8O4SSi/c1-26-25(34)23-22-21(33(31-23)17-37-12-13-39(3,4)5)10-11-27-24(22)28-14-18-8-6-7-9-20(18)32(2)38(35,36)19-15-29-30-16-19/h6-11,15-16H,12-14,17H2,1-5H3,(H,26,34)(H,27,28)(H,29,30) |
| InChIKey | VJRURCAFDJCWEX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 147.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.75 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|