C9H7FN2O2 — CID 142742316
3-fluoro-4H-1,4-benzoxazine-2-carboxamide (PubChem CID 142742316) has the molecular formula C9H7FN2O2 and a molecular weight of 194.17 g/mol. Its IUPAC name is 3-fluoro-4H-1,4-benzoxazine-2-carboxamide.
| Compound Name | 3-fluoro-4H-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 142742316 |
| Molecular Formula | C9H7FN2O2 |
| Molecular Weight | 194.17 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | 3-fluoro-4H-1,4-benzoxazine-2-carboxamide |
| SMILES | NC(=O)C1=C(F)Nc2ccccc2O1 |
| InChI | InChI=1S/C9H7FN2O2/c10-8-7(9(11)13)14-6-4-2-1-3-5(6)12-8/h1-4,12H,(H2,11,13) |
| InChIKey | TVLASTKHJRUSJK-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.17 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|