C14H13NO4 — CID 98115909
(2S)-3'-(1-hydroxyethylidene)-6'-methylspiro[3H-1,3-benzoxazole-2,4'-pyran]-2'-one (PubChem CID 98115909) has the molecular formula C14H13NO4 and a molecular weight of 259.26 g/mol. Its IUPAC name is (2S)-3'-(1-hydroxyethylidene)-6'-methylspiro[3H-1,3-benzoxazole-2,4'-pyran]-2'-one.
| Compound Name | (2S)-3'-(1-hydroxyethylidene)-6'-methylspiro[3H-1,3-benzoxazole-2,4'-pyran]-2'-one |
|---|---|
| PubChem CID | 98115909 |
| Molecular Formula | C14H13NO4 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | (2S)-3'-(1-hydroxyethylidene)-6'-methylspiro[3H-1,3-benzoxazole-2,4'-pyran]-2'-one |
| SMILES | CC1=C[C@@]2(Nc3ccccc3O2)C(=C(C)O)C(=O)O1 |
| InChI | InChI=1S/C14H13NO4/c1-8-7-14(12(9(2)16)13(17)18-8)15-10-5-3-4-6-11(10)19-14/h3-7,15-16H,1-2H3/t14-/m0/s1 |
| InChIKey | QRYDSVUFDLJOGV-AWEZNQCLSA-N |
| XLogP | 2.48 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|