C80H46Cl4F4N12 — CID 142756943
5,10,15,20-tetrakis[3-(2-chlorophenyl)-1-(4-fluorophenyl)pyrazol-4-yl]-21,23-dihydroporphyrin (PubChem CID 142756943) has the molecular formula C80H46Cl4F4N12 and a molecular weight of 1393.14 g/mol. Its IUPAC name is 5,10,15,20-tetrakis[3-(2-chlorophenyl)-1-(4-fluorophenyl)pyrazol-4-yl]-21,23-dihydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis[3-(2-chlorophenyl)-1-(4-fluorophenyl)pyrazol-4-yl]-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 142756943 |
| Molecular Formula | C80H46Cl4F4N12 |
| Molecular Weight | 1393.14 g/mol |
| Exact Mass | 1390.27 |
| IUPAC Name | 5,10,15,20-tetrakis[3-(2-chlorophenyl)-1-(4-fluorophenyl)pyrazol-4-yl]-21,23-dihydroporphyrin |
| SMILES | Fc1ccc(-n2cc(-c3c4nc(c(-c5cn(-c6ccc(F)cc6)nc5-c5ccccc5Cl)c5ccc([nH]5)c(-c5cn(-c6ccc(F)cc6)nc5-c5ccccc5Cl)c5nc(c(-c6cn(-c7ccc(F)cc7)nc6-c6ccccc6Cl)c6ccc3[nH]6)C=C5)C=C4)c(-c3ccccc3Cl)n2)cc1 |
| InChI | InChI=1S/C80H46Cl4F4N12/c81-61-13-5-1-9-53(61)77-57(41-97(93-77)49-25-17-45(85)18-26-49)73-65-33-35-67(89-65)74(58-42-98(50-27-19-46(86)20-28-50)94-78(58)54-10-2-6-14-62(54)82)69-37-39-71(91-69)76(60-44-100(52-31-23-48(88)24-32-52)96-80(60)56-12-4-8-16-64(56)84)72-40-38-70(92-72)75(68-36-34-66(73)90-68)59-43-99(51-29-21-47(87)22-30-51)95-79(59)55-11-3-7-15-63(55)83/h1-44,89,92H/b73-65-,73-66-,74-67-,74-69-,75-68-,75-70-,76-71-,76-72- |
| InChIKey | XAJQGZNXGREWPK-HTTNFVRMSA-N |
| XLogP | 21.90 |
| TPSA | 128.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 100 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1393.14 |
| LogP ≤ 5 | 21.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |