About propylazanium;propyl carbonate
propylazanium;propyl carbonate (PubChem CID 142757787) has the molecular formula C7H17NO3
and a molecular weight of 163.22 g/mol. Its IUPAC name is propylazanium;propyl carbonate.
Molecular Properties
| Compound Name | propylazanium;propyl carbonate |
| PubChem CID | 142757787 |
| Molecular Formula | C7H17NO3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.12 |
| IUPAC Name | propylazanium;propyl carbonate |
| SMILES | CCCOC(=O)[O-].CCC[NH3+] |
| InChI | InChI=1S/C4H8O3.C3H9N/c1-2-3-7-4(5)6;1-2-3-4/h2-3H2,1H3,(H,5,6);2-4H2,1H3 |
| InChIKey | QOCOPFWWEPTJGJ-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propylazanium;propyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propylazanium;propyl carbonate?
The IUPAC name of propylazanium;propyl carbonate (CID 142757787) is propylazanium;propyl carbonate.
What is the SMILES notation for propylazanium;propyl carbonate?
The canonical SMILES for propylazanium;propyl carbonate is CCCOC(=O)[O-].CCC[NH3+].
What is the InChIKey of propylazanium;propyl carbonate?
The InChIKey is QOCOPFWWEPTJGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O3.C3H9N/c1-2-3-7-4(5)6;1-2-3-4/h2-3H2,1H3,(H,5,6);2-4H2,1H3.
What are the key properties of propylazanium;propyl carbonate?
propylazanium;propyl carbonate has a molecular weight of 163.22 g/mol, XLogP of -0.61, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propylazanium;propyl carbonate is sourced from PubChem (CID 142757787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).