C27H39O9PSi — CID 142774471
[5-carboxy-9-[6-methoxy-7-methyl-3-oxo-4-(2-trimethylsilylethoxy)-1H-2-benzofuran-5-yl]-7-methylnona-2,7-dienylidene]-(hydroxymethoxy)-oxidophosphanium (PubChem CID 142774471) has the molecular formula C27H39O9PSi and a molecular weight of 566.66 g/mol. Its IUPAC name is [5-carboxy-9-[6-methoxy-7-methyl-3-oxo-4-(2-trimethylsilylethoxy)-1H-2-benzofuran-5-yl]-7-methylnona-2,7-dienylidene]-(hydroxymethoxy)-oxidophosphanium.
| Compound Name | [5-carboxy-9-[6-methoxy-7-methyl-3-oxo-4-(2-trimethylsilylethoxy)-1H-2-benzofuran-5-yl]-7-methylnona-2,7-dienylidene]-(hydroxymethoxy)-oxidophosphanium |
|---|---|
| PubChem CID | 142774471 |
| Molecular Formula | C27H39O9PSi |
| Molecular Weight | 566.66 g/mol |
| Exact Mass | 566.21 |
| IUPAC Name | [5-carboxy-9-[6-methoxy-7-methyl-3-oxo-4-(2-trimethylsilylethoxy)-1H-2-benzofuran-5-yl]-7-methylnona-2,7-dienylidene]-(hydroxymethoxy)-oxidophosphanium |
| SMILES | COc1c(C)c2c(c(OCC[Si](C)(C)C)c1CC=C(C)CC(CC=CC=[P+]([O-])OCO)C(=O)O)C(=O)OC2 |
| InChI | InChI=1S/C27H39O9PSi/c1-18(15-20(26(29)30)9-7-8-13-37(32)36-17-28)10-11-21-24(33-3)19(2)22-16-35-27(31)23(22)25(21)34-12-14-38(4,5)6/h7-8,10,13,20,28H,9,11-12,14-17H2,1-6H3,(H,29,30) |
| InChIKey | BBECKVJFLQFFPE-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 134.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.66 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|