C14H12N2O — CID 142778184
1-methoxy-5H-benzo[d][2,3]benzodiazepine (PubChem CID 142778184) has the molecular formula C14H12N2O and a molecular weight of 224.26 g/mol. Its IUPAC name is 1-methoxy-5H-benzo[d][2,3]benzodiazepine.
| Compound Name | 1-methoxy-5H-benzo[d][2,3]benzodiazepine |
|---|---|
| PubChem CID | 142778184 |
| Molecular Formula | C14H12N2O |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 1-methoxy-5H-benzo[d][2,3]benzodiazepine |
| SMILES | COc1cccc2c1-c1ccccc1C=NN2 |
| InChI | InChI=1S/C14H12N2O/c1-17-13-8-4-7-12-14(13)11-6-3-2-5-10(11)9-15-16-12/h2-9,16H,1H3 |
| InChIKey | AWCYJDVCBMDDLI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |