C15H13F2IN2O2 — CID 142788860
6-fluoro-7-(2-fluoro-4-iodoanilino)-1,2,3,5-tetrahydroindolizine-8-carboxylic acid (PubChem CID 142788860) has the molecular formula C15H13F2IN2O2 and a molecular weight of 418.18 g/mol. Its IUPAC name is 6-fluoro-7-(2-fluoro-4-iodoanilino)-1,2,3,5-tetrahydroindolizine-8-carboxylic acid.
| Compound Name | 6-fluoro-7-(2-fluoro-4-iodoanilino)-1,2,3,5-tetrahydroindolizine-8-carboxylic acid |
|---|---|
| PubChem CID | 142788860 |
| Molecular Formula | C15H13F2IN2O2 |
| Molecular Weight | 418.18 g/mol |
| Exact Mass | 418.00 |
| IUPAC Name | 6-fluoro-7-(2-fluoro-4-iodoanilino)-1,2,3,5-tetrahydroindolizine-8-carboxylic acid |
| SMILES | O=C(O)C1=C2CCCN2CC(F)=C1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C15H13F2IN2O2/c16-9-6-8(18)3-4-11(9)19-14-10(17)7-20-5-1-2-12(20)13(14)15(21)22/h3-4,6,19H,1-2,5,7H2,(H,21,22) |
| InChIKey | OKCFMVOUEJUHNK-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.18 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|