C18H14F3IN2O4 — CID 144631740
3,4-difluoro-2-(2-fluoro-4-iodoanilino)-5-[(3-oxooxazinan-2-yl)methyl]benzoic acid (PubChem CID 144631740) has the molecular formula C18H14F3IN2O4 and a molecular weight of 506.22 g/mol. Its IUPAC name is 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-5-[(3-oxooxazinan-2-yl)methyl]benzoic acid.
| Compound Name | 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-5-[(3-oxooxazinan-2-yl)methyl]benzoic acid |
|---|---|
| PubChem CID | 144631740 |
| Molecular Formula | C18H14F3IN2O4 |
| Molecular Weight | 506.22 g/mol |
| Exact Mass | 506.00 |
| IUPAC Name | 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-5-[(3-oxooxazinan-2-yl)methyl]benzoic acid |
| SMILES | O=C(O)c1cc(CN2OCCCC2=O)c(F)c(F)c1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C18H14F3IN2O4/c19-12-7-10(22)3-4-13(12)23-17-11(18(26)27)6-9(15(20)16(17)21)8-24-14(25)2-1-5-28-24/h3-4,6-7,23H,1-2,5,8H2,(H,26,27) |
| InChIKey | WHLNKOGFSGKNKO-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.22 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|