C23H29FN5O3+ — CID 142826148
(2-amino-1-hydroxy-3-phenylpropylidene)-[[(5R)-3-(3-fluoro-4-piperazin-1-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]azanium (PubChem CID 142826148) has the molecular formula C23H29FN5O3+ and a molecular weight of 442.52 g/mol. Its IUPAC name is (2-amino-1-hydroxy-3-phenylpropylidene)-[[(5R)-3-(3-fluoro-4-piperazin-1-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]azanium.
| Compound Name | (2-amino-1-hydroxy-3-phenylpropylidene)-[[(5R)-3-(3-fluoro-4-piperazin-1-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]azanium |
|---|---|
| PubChem CID | 142826148 |
| Molecular Formula | C23H29FN5O3+ |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | (2-amino-1-hydroxy-3-phenylpropylidene)-[[(5R)-3-(3-fluoro-4-piperazin-1-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]azanium |
| SMILES | NC(Cc1ccccc1)/C(O)=[NH+]/C[C@H]1CN(c2ccc(N3CCNCC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C23H28FN5O3/c24-19-13-17(6-7-21(19)28-10-8-26-9-11-28)29-15-18(32-23(29)31)14-27-22(30)20(25)12-16-4-2-1-3-5-16/h1-7,13,18,20,26H,8-12,14-15,25H2,(H,27,30)/p+1/t18-,20?/m0/s1 |
| InChIKey | KSNDYAGWKJGZKP-LROBGIAVSA-O |
| XLogP | 0.17 |
| TPSA | 105.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|