C31H40F5N3O5S — CID 142845822
1-cyclopropyl-N-(oxan-2-yloxy)-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]phenyl]sulfonylpiperidine-4-carboxamide;ethane (PubChem CID 142845822) has the molecular formula C31H40F5N3O5S and a molecular weight of 661.73 g/mol. Its IUPAC name is 1-cyclopropyl-N-(oxan-2-yloxy)-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]phenyl]sulfonylpiperidine-4-carboxamide;ethane.
| Compound Name | 1-cyclopropyl-N-(oxan-2-yloxy)-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]phenyl]sulfonylpiperidine-4-carboxamide;ethane |
|---|---|
| PubChem CID | 142845822 |
| Molecular Formula | C31H40F5N3O5S |
| Molecular Weight | 661.73 g/mol |
| Exact Mass | 661.26 |
| IUPAC Name | 1-cyclopropyl-N-(oxan-2-yloxy)-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]phenyl]sulfonylpiperidine-4-carboxamide;ethane |
| SMILES | CC.O=C(NOC1CCCCO1)C1(S(=O)(=O)c2ccc(-c3ccc(CCC(F)(F)C(F)(F)F)cn3)cc2)CCN(C2CC2)CC1 |
| InChI | InChI=1S/C29H34F5N3O5S.C2H6/c30-28(31,29(32,33)34)13-12-20-4-11-24(35-19-20)21-5-9-23(10-6-21)43(39,40)27(14-16-37(17-15-27)22-7-8-22)26(38)36-42-25-3-1-2-18-41-25;1-2/h4-6,9-11,19,22,25H,1-3,7-8,12-18H2,(H,36,38);1-2H3 |
| InChIKey | LLOWGHHFBDUPKP-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.73 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|