C23H21ClN4O3 — CID 142846586
5-(4-chlorophenyl)-N-[3-cyano-4-(4-hydroxyazepan-1-yl)phenyl]-1,3-oxazole-2-carboxamide (PubChem CID 142846586) has the molecular formula C23H21ClN4O3 and a molecular weight of 436.90 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-[3-cyano-4-(4-hydroxyazepan-1-yl)phenyl]-1,3-oxazole-2-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-N-[3-cyano-4-(4-hydroxyazepan-1-yl)phenyl]-1,3-oxazole-2-carboxamide |
|---|---|
| PubChem CID | 142846586 |
| Molecular Formula | C23H21ClN4O3 |
| Molecular Weight | 436.90 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 5-(4-chlorophenyl)-N-[3-cyano-4-(4-hydroxyazepan-1-yl)phenyl]-1,3-oxazole-2-carboxamide |
| SMILES | N#Cc1cc(NC(=O)c2ncc(-c3ccc(Cl)cc3)o2)ccc1N1CCCC(O)CC1 |
| InChI | InChI=1S/C23H21ClN4O3/c24-17-5-3-15(4-6-17)21-14-26-23(31-21)22(30)27-18-7-8-20(16(12-18)13-25)28-10-1-2-19(29)9-11-28/h3-8,12,14,19,29H,1-2,9-11H2,(H,27,30) |
| InChIKey | MJVLBRIPDXYAHV-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 102.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.90 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|