C11H18N2 — CID 142864209
N-[(1Z,3Z)-3-piperidin-4-ylpenta-1,3-dienyl]methanimine (PubChem CID 142864209) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is N-[(1Z,3Z)-3-piperidin-4-ylpenta-1,3-dienyl]methanimine.
| Compound Name | N-[(1Z,3Z)-3-piperidin-4-ylpenta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 142864209 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | N-[(1Z,3Z)-3-piperidin-4-ylpenta-1,3-dienyl]methanimine |
| SMILES | C=N/C=C\C(=C/C)C1CCNCC1 |
| InChI | InChI=1S/C11H18N2/c1-3-10(4-7-12-2)11-5-8-13-9-6-11/h3-4,7,11,13H,2,5-6,8-9H2,1H3/b7-4-,10-3+ |
| InChIKey | KBAZCOSBJBRRMK-PZPRPFQRSA-N |
| XLogP | 2.15 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|