C19H15ClN2O3 — CID 142864699
4-[(4-chloro-2H-indol-5-yl)oxy]-6,7-dimethoxyquinoline (PubChem CID 142864699) has the molecular formula C19H15ClN2O3 and a molecular weight of 354.79 g/mol. Its IUPAC name is 4-[(4-chloro-2H-indol-5-yl)oxy]-6,7-dimethoxyquinoline.
| Compound Name | 4-[(4-chloro-2H-indol-5-yl)oxy]-6,7-dimethoxyquinoline |
|---|---|
| PubChem CID | 142864699 |
| Molecular Formula | C19H15ClN2O3 |
| Molecular Weight | 354.79 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 4-[(4-chloro-2H-indol-5-yl)oxy]-6,7-dimethoxyquinoline |
| SMILES | COc1cc2nccc(Oc3ccc4c(c3Cl)=CCN=4)c2cc1OC |
| InChI | InChI=1S/C19H15ClN2O3/c1-23-17-9-12-14(10-18(17)24-2)22-8-6-15(12)25-16-4-3-13-11(19(16)20)5-7-21-13/h3-6,8-10H,7H2,1-2H3 |
| InChIKey | PNZXDQJBYLSLAL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 52.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.79 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |