C22H34ClN7O — CID 142876026
4-[[4-(1-aminohexan-3-ylamino)-6-(cycloheptylamino)-1,3,5-triazin-2-yl]amino]-2-chlorophenol (PubChem CID 142876026) has the molecular formula C22H34ClN7O and a molecular weight of 448.02 g/mol. Its IUPAC name is 4-[[4-(1-aminohexan-3-ylamino)-6-(cycloheptylamino)-1,3,5-triazin-2-yl]amino]-2-chlorophenol.
| Compound Name | 4-[[4-(1-aminohexan-3-ylamino)-6-(cycloheptylamino)-1,3,5-triazin-2-yl]amino]-2-chlorophenol |
|---|---|
| PubChem CID | 142876026 |
| Molecular Formula | C22H34ClN7O |
| Molecular Weight | 448.02 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | 4-[[4-(1-aminohexan-3-ylamino)-6-(cycloheptylamino)-1,3,5-triazin-2-yl]amino]-2-chlorophenol |
| SMILES | CCCC(CCN)Nc1nc(Nc2ccc(O)c(Cl)c2)nc(NC2CCCCCC2)n1 |
| InChI | InChI=1S/C22H34ClN7O/c1-2-7-15(12-13-24)25-20-28-21(26-16-8-5-3-4-6-9-16)30-22(29-20)27-17-10-11-19(31)18(23)14-17/h10-11,14-16,31H,2-9,12-13,24H2,1H3,(H3,25,26,27,28,29,30) |
| InChIKey | CZGPUMVADPWNFR-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 121.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.02 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|