C24H36N2O — CID 142888773
(2E,3Z,5E)-2-ethylidene-6-[[(6E)-7-hexan-3-yloxy-4-methyl-5-methylideneocta-1,6-dien-2-yl]amino]hexa-3,5-dienenitrile (PubChem CID 142888773) has the molecular formula C24H36N2O and a molecular weight of 368.57 g/mol. Its IUPAC name is (2E,3Z,5E)-2-ethylidene-6-[[(6E)-7-hexan-3-yloxy-4-methyl-5-methylideneocta-1,6-dien-2-yl]amino]hexa-3,5-dienenitrile.
| Compound Name | (2E,3Z,5E)-2-ethylidene-6-[[(6E)-7-hexan-3-yloxy-4-methyl-5-methylideneocta-1,6-dien-2-yl]amino]hexa-3,5-dienenitrile |
|---|---|
| PubChem CID | 142888773 |
| Molecular Formula | C24H36N2O |
| Molecular Weight | 368.57 g/mol |
| Exact Mass | 368.28 |
| IUPAC Name | (2E,3Z,5E)-2-ethylidene-6-[[(6E)-7-hexan-3-yloxy-4-methyl-5-methylideneocta-1,6-dien-2-yl]amino]hexa-3,5-dienenitrile |
| SMILES | C=C(CC(C)C(=C)/C=C(\C)OC(CC)CCC)N/C=C/C=C\C(C#N)=C/C |
| InChI | InChI=1S/C24H36N2O/c1-8-13-24(10-3)27-22(7)17-20(5)19(4)16-21(6)26-15-12-11-14-23(9-2)18-25/h9,11-12,14-15,17,19,24,26H,5-6,8,10,13,16H2,1-4,7H3/b14-11-,15-12+,22-17+,23-9+ |
| InChIKey | XNWAGRMSTLUSPM-XCVHINEPSA-N |
| XLogP | 6.71 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.57 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|