About ethane;4-[(E)-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-yl]benzaldehyde
ethane;4-[(E)-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-yl]benzaldehyde (PubChem CID 142889389) has the molecular formula C22H32O
and a molecular weight of 312.50 g/mol. Its IUPAC name is ethane;4-[(E)-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-yl]benzaldehyde.
Molecular Properties
| Compound Name | ethane;4-[(E)-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-yl]benzaldehyde |
| PubChem CID | 142889389 |
| Molecular Formula | C22H32O |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | ethane;4-[(E)-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-yl]benzaldehyde |
| SMILES | CC.CC1=C(/C=C/C(C)c2ccc(C=O)cc2)C(C)(C)CCC1 |
| InChI | InChI=1S/C20H26O.C2H6/c1-15(18-10-8-17(14-21)9-11-18)7-12-19-16(2)6-5-13-20(19,3)4;1-2/h7-12,14-15H,5-6,13H2,1-4H3;1-2H3/b12-7+; |
| InChIKey | HWJXWIKYQKLSME-RRAJOLSVSA-N |
| XLogP | 6.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethane;4-[(E)-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-yl]benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-[(E)-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-yl]benzaldehyde?
The IUPAC name of ethane;4-[(E)-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-yl]benzaldehyde (CID 142889389) is ethane;4-[(E)-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-yl]benzaldehyde.
What is the SMILES notation for ethane;4-[(E)-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-yl]benzaldehyde?
The canonical SMILES for ethane;4-[(E)-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-yl]benzaldehyde is CC.CC1=C(/C=C/C(C)c2ccc(C=O)cc2)C(C)(C)CCC1.
What is the InChIKey of ethane;4-[(E)-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-yl]benzaldehyde?
The InChIKey is HWJXWIKYQKLSME-RRAJOLSVSA-N. The full InChI is InChI=1S/C20H26O.C2H6/c1-15(18-10-8-17(14-21)9-11-18)7-12-19-16(2)6-5-13-20(19,3)4;1-2/h7-12,14-15H,5-6,13H2,1-4H3;1-2H3/b12-7+;.
What are the key properties of ethane;4-[(E)-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-yl]benzaldehyde?
ethane;4-[(E)-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-yl]benzaldehyde has a molecular weight of 312.50 g/mol, XLogP of 6.71, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-[(E)-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-yl]benzaldehyde is sourced from PubChem (CID 142889389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).