C19H26N2 — CID 57140272
phenyl-[4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-yl]diazene (PubChem CID 57140272) has the molecular formula C19H26N2 and a molecular weight of 282.43 g/mol. Its IUPAC name is phenyl-[4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-yl]diazene.
| Compound Name | phenyl-[4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-yl]diazene |
|---|---|
| PubChem CID | 57140272 |
| Molecular Formula | C19H26N2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | phenyl-[4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-yl]diazene |
| SMILES | CC1=C(C=CC(C)/N=N/c2ccccc2)C(C)(C)CCC1 |
| InChI | InChI=1S/C19H26N2/c1-15-9-8-14-19(3,4)18(15)13-12-16(2)20-21-17-10-6-5-7-11-17/h5-7,10-13,16H,8-9,14H2,1-4H3/b13-12?,21-20+ |
| InChIKey | JCKYGLGSWJPAFL-TWVZHIECSA-N |
| XLogP | 6.24 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|