C26H31BClN3O4 — CID 142894006
[4-[[3-[2-[(2R)-2-[(6-chloropyrimidin-4-yl)amino]hexanoyl]oxyethyl]phenyl]methoxy]phenyl]-methylborinic acid (PubChem CID 142894006) has the molecular formula C26H31BClN3O4 and a molecular weight of 495.82 g/mol. Its IUPAC name is [4-[[3-[2-[(2R)-2-[(6-chloropyrimidin-4-yl)amino]hexanoyl]oxyethyl]phenyl]methoxy]phenyl]-methylborinic acid.
| Compound Name | [4-[[3-[2-[(2R)-2-[(6-chloropyrimidin-4-yl)amino]hexanoyl]oxyethyl]phenyl]methoxy]phenyl]-methylborinic acid |
|---|---|
| PubChem CID | 142894006 |
| Molecular Formula | C26H31BClN3O4 |
| Molecular Weight | 495.82 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | [4-[[3-[2-[(2R)-2-[(6-chloropyrimidin-4-yl)amino]hexanoyl]oxyethyl]phenyl]methoxy]phenyl]-methylborinic acid |
| SMILES | CCCC[C@@H](Nc1cc(Cl)ncn1)C(=O)OCCc1cccc(COc2ccc(B(C)O)cc2)c1 |
| InChI | InChI=1S/C26H31BClN3O4/c1-3-4-8-23(31-25-16-24(28)29-18-30-25)26(32)34-14-13-19-6-5-7-20(15-19)17-35-22-11-9-21(10-12-22)27(2)33/h5-7,9-12,15-16,18,23,33H,3-4,8,13-14,17H2,1-2H3,(H,29,30,31)/t23-/m1/s1 |
| InChIKey | KQBSNBJLGPKDBR-HSZRJFAPSA-N |
| XLogP | 4.29 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.82 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|