C30H40F3N3O2S — CID 142896716
5,6-dihydro-4H-1,3-thiazin-2-yl-[4-[2-[9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]ethyl]oxan-4-yl]methanone;ethane (PubChem CID 142896716) has the molecular formula C30H40F3N3O2S and a molecular weight of 563.73 g/mol. Its IUPAC name is 5,6-dihydro-4H-1,3-thiazin-2-yl-[4-[2-[9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]ethyl]oxan-4-yl]methanone;ethane.
| Compound Name | 5,6-dihydro-4H-1,3-thiazin-2-yl-[4-[2-[9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]ethyl]oxan-4-yl]methanone;ethane |
|---|---|
| PubChem CID | 142896716 |
| Molecular Formula | C30H40F3N3O2S |
| Molecular Weight | 563.73 g/mol |
| Exact Mass | 563.28 |
| IUPAC Name | 5,6-dihydro-4H-1,3-thiazin-2-yl-[4-[2-[9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]ethyl]oxan-4-yl]methanone;ethane |
| SMILES | CC.O=C(C1=NCCCS1)C1(CCN2CCC3Cc4[nH]c5ccc(C(F)(F)F)cc5c4CC3C2)CCOCC1 |
| InChI | InChI=1S/C28H34F3N3O2S.C2H6/c29-28(30,31)20-2-3-23-22(16-20)21-14-19-17-34(9-4-18(19)15-24(21)33-23)10-5-27(6-11-36-12-7-27)25(35)26-32-8-1-13-37-26;1-2/h2-3,16,18-19,33H,1,4-15,17H2;1-2H3 |
| InChIKey | KZAFYRBWMSLYGX-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 57.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.73 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|