About (3-amino-3-oxopropyl) thiohypofluorite;ethane
(3-amino-3-oxopropyl) thiohypofluorite;ethane (PubChem CID 142920454) has the molecular formula C5H12FNOS
and a molecular weight of 153.22 g/mol. Its IUPAC name is (3-amino-3-oxopropyl) thiohypofluorite;ethane.
Molecular Properties
| Compound Name | (3-amino-3-oxopropyl) thiohypofluorite;ethane |
| PubChem CID | 142920454 |
| Molecular Formula | C5H12FNOS |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.06 |
| IUPAC Name | (3-amino-3-oxopropyl) thiohypofluorite;ethane |
| SMILES | CC.NC(=O)CCSF |
| InChI | InChI=1S/C3H6FNOS.C2H6/c4-7-2-1-3(5)6;1-2/h1-2H2,(H2,5,6);1-2H3 |
| InChIKey | QENDHHASZMRWDA-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3-amino-3-oxopropyl) thiohypofluorite;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-amino-3-oxopropyl) thiohypofluorite;ethane?
The IUPAC name of (3-amino-3-oxopropyl) thiohypofluorite;ethane (CID 142920454) is (3-amino-3-oxopropyl) thiohypofluorite;ethane.
What is the SMILES notation for (3-amino-3-oxopropyl) thiohypofluorite;ethane?
The canonical SMILES for (3-amino-3-oxopropyl) thiohypofluorite;ethane is CC.NC(=O)CCSF.
What is the InChIKey of (3-amino-3-oxopropyl) thiohypofluorite;ethane?
The InChIKey is QENDHHASZMRWDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6FNOS.C2H6/c4-7-2-1-3(5)6;1-2/h1-2H2,(H2,5,6);1-2H3.
What are the key properties of (3-amino-3-oxopropyl) thiohypofluorite;ethane?
(3-amino-3-oxopropyl) thiohypofluorite;ethane has a molecular weight of 153.22 g/mol, XLogP of 1.51, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-amino-3-oxopropyl) thiohypofluorite;ethane is sourced from PubChem (CID 142920454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).