C47H56O3 — CID 142932691
2,6-ditert-butyl-4-[[5-[(2E,3Z)-1-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)-2-ethylidenehexa-3,5-dienyl]furan-2-yl]-phenylmethylidene]cyclohexa-2,5-dien-1-one (PubChem CID 142932691) has the molecular formula C47H56O3 and a molecular weight of 668.96 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[[5-[(2E,3Z)-1-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)-2-ethylidenehexa-3,5-dienyl]furan-2-yl]-phenylmethylidene]cyclohexa-2,5-dien-1-one.
| Compound Name | 2,6-ditert-butyl-4-[[5-[(2E,3Z)-1-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)-2-ethylidenehexa-3,5-dienyl]furan-2-yl]-phenylmethylidene]cyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 142932691 |
| Molecular Formula | C47H56O3 |
| Molecular Weight | 668.96 g/mol |
| Exact Mass | 668.42 |
| IUPAC Name | 2,6-ditert-butyl-4-[[5-[(2E,3Z)-1-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)-2-ethylidenehexa-3,5-dienyl]furan-2-yl]-phenylmethylidene]cyclohexa-2,5-dien-1-one |
| SMILES | C=C/C=C\C(=C/C)C(=C1C=C(C(C)(C)C)C(=O)C(C(C)(C)C)=C1)c1ccc(C(=C2C=C(C(C)(C)C)C(=O)C(C(C)(C)C)=C2)c2ccccc2)o1 |
| InChI | InChI=1S/C47H56O3/c1-15-17-21-30(16-2)40(32-26-34(44(3,4)5)42(48)35(27-32)45(6,7)8)38-24-25-39(50-38)41(31-22-19-18-20-23-31)33-28-36(46(9,10)11)43(49)37(29-33)47(12,13)14/h15-29H,1H2,2-14H3/b21-17-,30-16+ |
| InChIKey | YIPKCZOMFDAZGT-MNNKJKQESA-N |
| XLogP | 12.58 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.96 |
| LogP ≤ 5 | 12.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|