C16H24 — CID 142950691
2-(2-ethenyl-5-methylhex-4-enyl)-5-methylcyclohexa-1,3-diene (PubChem CID 142950691) has the molecular formula C16H24 and a molecular weight of 216.37 g/mol. Its IUPAC name is 2-(2-ethenyl-5-methylhex-4-enyl)-5-methylcyclohexa-1,3-diene.
| Compound Name | 2-(2-ethenyl-5-methylhex-4-enyl)-5-methylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 142950691 |
| Molecular Formula | C16H24 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | 2-(2-ethenyl-5-methylhex-4-enyl)-5-methylcyclohexa-1,3-diene |
| SMILES | C=CC(CC=C(C)C)CC1=CCC(C)C=C1 |
| InChI | InChI=1S/C16H24/c1-5-15(9-6-13(2)3)12-16-10-7-14(4)8-11-16/h5-7,10-11,14-15H,1,8-9,12H2,2-4H3 |
| InChIKey | BRQMHJPAXZSFDN-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|