About 2-(2-ethenyl-5-methylhex-4-enyl)-5-methylcyclohexa-1,3-diene
2-(2-ethenyl-5-methylhex-4-enyl)-5-methylcyclohexa-1,3-diene (PubChem CID 142950691) has the molecular formula C16H24
and a molecular weight of 216.37 g/mol. Its IUPAC name is 2-(2-ethenyl-5-methylhex-4-enyl)-5-methylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 2-(2-ethenyl-5-methylhex-4-enyl)-5-methylcyclohexa-1,3-diene |
| PubChem CID | 142950691 |
| Molecular Formula | C16H24 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | 2-(2-ethenyl-5-methylhex-4-enyl)-5-methylcyclohexa-1,3-diene |
| SMILES | C=CC(CC=C(C)C)CC1=CCC(C)C=C1 |
| InChI | InChI=1S/C16H24/c1-5-15(9-6-13(2)3)12-16-10-7-14(4)8-11-16/h5-7,10-11,14-15H,1,8-9,12H2,2-4H3 |
| InChIKey | BRQMHJPAXZSFDN-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-ethenyl-5-methylhex-4-enyl)-5-methylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-ethenyl-5-methylhex-4-enyl)-5-methylcyclohexa-1,3-diene?
The IUPAC name of 2-(2-ethenyl-5-methylhex-4-enyl)-5-methylcyclohexa-1,3-diene (CID 142950691) is 2-(2-ethenyl-5-methylhex-4-enyl)-5-methylcyclohexa-1,3-diene.
What is the SMILES notation for 2-(2-ethenyl-5-methylhex-4-enyl)-5-methylcyclohexa-1,3-diene?
The canonical SMILES for 2-(2-ethenyl-5-methylhex-4-enyl)-5-methylcyclohexa-1,3-diene is C=CC(CC=C(C)C)CC1=CCC(C)C=C1.
What is the InChIKey of 2-(2-ethenyl-5-methylhex-4-enyl)-5-methylcyclohexa-1,3-diene?
The InChIKey is BRQMHJPAXZSFDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24/c1-5-15(9-6-13(2)3)12-16-10-7-14(4)8-11-16/h5-7,10-11,14-15H,1,8-9,12H2,2-4H3.
What are the key properties of 2-(2-ethenyl-5-methylhex-4-enyl)-5-methylcyclohexa-1,3-diene?
2-(2-ethenyl-5-methylhex-4-enyl)-5-methylcyclohexa-1,3-diene has a molecular weight of 216.37 g/mol, XLogP of 5.06, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-ethenyl-5-methylhex-4-enyl)-5-methylcyclohexa-1,3-diene is sourced from PubChem (CID 142950691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).