C14H21N — CID 143521583
N-[3-(4-methylcyclohexa-1,5-dien-1-yl)prop-1-en-2-yl]butan-2-imine (PubChem CID 143521583) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is N-[3-(4-methylcyclohexa-1,5-dien-1-yl)prop-1-en-2-yl]butan-2-imine.
| Compound Name | N-[3-(4-methylcyclohexa-1,5-dien-1-yl)prop-1-en-2-yl]butan-2-imine |
|---|---|
| PubChem CID | 143521583 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | N-[3-(4-methylcyclohexa-1,5-dien-1-yl)prop-1-en-2-yl]butan-2-imine |
| SMILES | C=C(CC1=CCC(C)C=C1)/N=C(\C)CC |
| InChI | InChI=1S/C14H21N/c1-5-12(3)15-13(4)10-14-8-6-11(2)7-9-14/h6,8-9,11H,4-5,7,10H2,1-3H3/b15-12+ |
| InChIKey | SAXZBPVJWOWNBC-NTCAYCPXSA-N |
| XLogP | 4.28 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|