C21H35O2P — CID 142963761
[6-methyl-5-(3-methyl-6-phosphanylhexyl)-3,4,5,6-tetrahydro-2H-naphthalen-4a-yl] propanoate (PubChem CID 142963761) has the molecular formula C21H35O2P and a molecular weight of 350.48 g/mol. Its IUPAC name is [6-methyl-5-(3-methyl-6-phosphanylhexyl)-3,4,5,6-tetrahydro-2H-naphthalen-4a-yl] propanoate.
| Compound Name | [6-methyl-5-(3-methyl-6-phosphanylhexyl)-3,4,5,6-tetrahydro-2H-naphthalen-4a-yl] propanoate |
|---|---|
| PubChem CID | 142963761 |
| Molecular Formula | C21H35O2P |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | [6-methyl-5-(3-methyl-6-phosphanylhexyl)-3,4,5,6-tetrahydro-2H-naphthalen-4a-yl] propanoate |
| SMILES | CCC(=O)OC12CCCC=C1C=CC(C)C2CCC(C)CCCP |
| InChI | InChI=1S/C21H35O2P/c1-4-20(22)23-21-14-6-5-9-18(21)12-11-17(3)19(21)13-10-16(2)8-7-15-24/h9,11-12,16-17,19H,4-8,10,13-15,24H2,1-3H3 |
| InChIKey | VFKWGLZJAJOODU-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|