C13H13F3 — CID 142964428
2,4-difluoro-1-[(3E)-3-fluoro-5-methylhexa-1,3,5-trien-2-yl]cyclohexa-1,3-diene (PubChem CID 142964428) has the molecular formula C13H13F3 and a molecular weight of 226.24 g/mol. Its IUPAC name is 2,4-difluoro-1-[(3E)-3-fluoro-5-methylhexa-1,3,5-trien-2-yl]cyclohexa-1,3-diene.
| Compound Name | 2,4-difluoro-1-[(3E)-3-fluoro-5-methylhexa-1,3,5-trien-2-yl]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 142964428 |
| Molecular Formula | C13H13F3 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 2,4-difluoro-1-[(3E)-3-fluoro-5-methylhexa-1,3,5-trien-2-yl]cyclohexa-1,3-diene |
| SMILES | C=C(C)/C=C(/F)C(=C)C1=C(F)C=C(F)CC1 |
| InChI | InChI=1S/C13H13F3/c1-8(2)6-12(15)9(3)11-5-4-10(14)7-13(11)16/h6-7H,1,3-5H2,2H3/b12-6+ |
| InChIKey | AFWPLOISZCKLHM-WUXMJOGZSA-N |
| XLogP | 4.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|