C19H30N4O2S — CID 142982879
1-[4-[4-[hydroxy-[[(E)-2-(methylamino)prop-1-enyl]amino]methyl]-1,3-thiazol-2-yl]piperidin-1-yl]hex-5-en-1-one (PubChem CID 142982879) has the molecular formula C19H30N4O2S and a molecular weight of 378.54 g/mol. Its IUPAC name is 1-[4-[4-[hydroxy-[[(E)-2-(methylamino)prop-1-enyl]amino]methyl]-1,3-thiazol-2-yl]piperidin-1-yl]hex-5-en-1-one.
| Compound Name | 1-[4-[4-[hydroxy-[[(E)-2-(methylamino)prop-1-enyl]amino]methyl]-1,3-thiazol-2-yl]piperidin-1-yl]hex-5-en-1-one |
|---|---|
| PubChem CID | 142982879 |
| Molecular Formula | C19H30N4O2S |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 1-[4-[4-[hydroxy-[[(E)-2-(methylamino)prop-1-enyl]amino]methyl]-1,3-thiazol-2-yl]piperidin-1-yl]hex-5-en-1-one |
| SMILES | C=CCCCC(=O)N1CCC(c2nc(C(O)N/C=C(\C)NC)cs2)CC1 |
| InChI | InChI=1S/C19H30N4O2S/c1-4-5-6-7-17(24)23-10-8-15(9-11-23)19-22-16(13-26-19)18(25)21-12-14(2)20-3/h4,12-13,15,18,20-21,25H,1,5-11H2,2-3H3/b14-12+ |
| InChIKey | OTOJJZLJBLBVIW-WYMLVPIESA-N |
| XLogP | 2.87 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|