C31H27F4N3O2 — CID 143000294
N-[3-benzyl-5-(4-methoxyphenyl)pyrazin-2-yl]-N-methyl-2-[2,3,4,5-tetrafluoro-6-(2-methylprop-1-enyl)phenyl]acetamide (PubChem CID 143000294) has the molecular formula C31H27F4N3O2 and a molecular weight of 549.57 g/mol. Its IUPAC name is N-[3-benzyl-5-(4-methoxyphenyl)pyrazin-2-yl]-N-methyl-2-[2,3,4,5-tetrafluoro-6-(2-methylprop-1-enyl)phenyl]acetamide.
| Compound Name | N-[3-benzyl-5-(4-methoxyphenyl)pyrazin-2-yl]-N-methyl-2-[2,3,4,5-tetrafluoro-6-(2-methylprop-1-enyl)phenyl]acetamide |
|---|---|
| PubChem CID | 143000294 |
| Molecular Formula | C31H27F4N3O2 |
| Molecular Weight | 549.57 g/mol |
| Exact Mass | 549.20 |
| IUPAC Name | N-[3-benzyl-5-(4-methoxyphenyl)pyrazin-2-yl]-N-methyl-2-[2,3,4,5-tetrafluoro-6-(2-methylprop-1-enyl)phenyl]acetamide |
| SMILES | COc1ccc(-c2cnc(N(C)C(=O)Cc3c(F)c(F)c(F)c(F)c3C=C(C)C)c(Cc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C31H27F4N3O2/c1-18(2)14-22-23(28(33)30(35)29(34)27(22)32)16-26(39)38(3)31-24(15-19-8-6-5-7-9-19)37-25(17-36-31)20-10-12-21(40-4)13-11-20/h5-14,17H,15-16H2,1-4H3 |
| InChIKey | NNJXFYFKTZIWRZ-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.57 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|