C19H38N5O8P — CID 143010594
[3-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]-1-(2-methoxyethoxy)pentan-2-yl] methyl hydrogen phosphate;ethane (PubChem CID 143010594) has the molecular formula C19H38N5O8P and a molecular weight of 495.51 g/mol. Its IUPAC name is [3-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]-1-(2-methoxyethoxy)pentan-2-yl] methyl hydrogen phosphate;ethane.
| Compound Name | [3-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]-1-(2-methoxyethoxy)pentan-2-yl] methyl hydrogen phosphate;ethane |
|---|---|
| PubChem CID | 143010594 |
| Molecular Formula | C19H38N5O8P |
| Molecular Weight | 495.51 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | [3-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]-1-(2-methoxyethoxy)pentan-2-yl] methyl hydrogen phosphate;ethane |
| SMILES | CC.CC.CCC(OCn1cnc2c(=O)[nH]c(N)nc21)C(COCCOC)OP(=O)(O)OC |
| InChI | InChI=1S/C15H26N5O8P.2C2H6/c1-4-10(11(7-26-6-5-24-2)28-29(22,23)25-3)27-9-20-8-17-12-13(20)18-15(16)19-14(12)21;2*1-2/h8,10-11H,4-7,9H2,1-3H3,(H,22,23)(H3,16,18,19,21);2*1-2H3 |
| InChIKey | MZYROMIRWIJHJZ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 173.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.51 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|