C18H34O — CID 143044684
ethane;1-[(1Z,3E)-3-methoxypenta-1,3-dienyl]-5,6-dimethylcyclohexene (PubChem CID 143044684) has the molecular formula C18H34O and a molecular weight of 266.47 g/mol. Its IUPAC name is ethane;1-[(1Z,3E)-3-methoxypenta-1,3-dienyl]-5,6-dimethylcyclohexene.
| Compound Name | ethane;1-[(1Z,3E)-3-methoxypenta-1,3-dienyl]-5,6-dimethylcyclohexene |
|---|---|
| PubChem CID | 143044684 |
| Molecular Formula | C18H34O |
| Molecular Weight | 266.47 g/mol |
| Exact Mass | 266.26 |
| IUPAC Name | ethane;1-[(1Z,3E)-3-methoxypenta-1,3-dienyl]-5,6-dimethylcyclohexene |
| SMILES | C/C=C(\C=C/C1=CCCC(C)C1C)OC.CC.CC |
| InChI | InChI=1S/C14H22O.2C2H6/c1-5-14(15-4)10-9-13-8-6-7-11(2)12(13)3;2*1-2/h5,8-12H,6-7H2,1-4H3;2*1-2H3/b10-9-,14-5+;; |
| InChIKey | QZOZHTXWZGSBTF-CDGNPMRUSA-N |
| XLogP | 6.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.47 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|