C21H24ClN — CID 143048407
(3E,5E)-6-chloro-N-[1-[4-[(E)-3,3-dimethylbut-1-enyl]phenyl]ethenyl]hepta-3,5-dien-1-yn-3-amine (PubChem CID 143048407) has the molecular formula C21H24ClN and a molecular weight of 325.88 g/mol. Its IUPAC name is (3E,5E)-6-chloro-N-[1-[4-[(E)-3,3-dimethylbut-1-enyl]phenyl]ethenyl]hepta-3,5-dien-1-yn-3-amine.
| Compound Name | (3E,5E)-6-chloro-N-[1-[4-[(E)-3,3-dimethylbut-1-enyl]phenyl]ethenyl]hepta-3,5-dien-1-yn-3-amine |
|---|---|
| PubChem CID | 143048407 |
| Molecular Formula | C21H24ClN |
| Molecular Weight | 325.88 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | (3E,5E)-6-chloro-N-[1-[4-[(E)-3,3-dimethylbut-1-enyl]phenyl]ethenyl]hepta-3,5-dien-1-yn-3-amine |
| SMILES | C#C/C(=C\C=C(/C)Cl)NC(=C)c1ccc(/C=C/C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H24ClN/c1-7-20(13-8-16(2)22)23-17(3)19-11-9-18(10-12-19)14-15-21(4,5)6/h1,8-15,23H,3H2,2,4-6H3/b15-14+,16-8+,20-13+ |
| InChIKey | RVPFZOSUPMYZDW-ZEXKCAMQSA-N |
| XLogP | 5.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.88 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|