C34H47FN6O3 — CID 143055555
(3S,5R)-N-[3-[2-(2-fluoro-4-methoxyphenyl)ethyl]-2,4-dioxo-1H-quinazolin-7-yl]-3,5-dimethyl-N'-[(1S,2S,5R)-2,4,4,5-tetramethylcyclohexyl]piperazine-1-carboximidamide (PubChem CID 143055555) has the molecular formula C34H47FN6O3 and a molecular weight of 606.79 g/mol. Its IUPAC name is (3S,5R)-N-[3-[2-(2-fluoro-4-methoxyphenyl)ethyl]-2,4-dioxo-1H-quinazolin-7-yl]-3,5-dimethyl-N'-[(1S,2S,5R)-2,4,4,5-tetramethylcyclohexyl]piperazine-1-carboximidamide.
| Compound Name | (3S,5R)-N-[3-[2-(2-fluoro-4-methoxyphenyl)ethyl]-2,4-dioxo-1H-quinazolin-7-yl]-3,5-dimethyl-N'-[(1S,2S,5R)-2,4,4,5-tetramethylcyclohexyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 143055555 |
| Molecular Formula | C34H47FN6O3 |
| Molecular Weight | 606.79 g/mol |
| Exact Mass | 606.37 |
| IUPAC Name | (3S,5R)-N-[3-[2-(2-fluoro-4-methoxyphenyl)ethyl]-2,4-dioxo-1H-quinazolin-7-yl]-3,5-dimethyl-N'-[(1S,2S,5R)-2,4,4,5-tetramethylcyclohexyl]piperazine-1-carboximidamide |
| SMILES | COc1ccc(CCn2c(=O)[nH]c3cc(N/C(=N/[C@H]4C[C@@H](C)C(C)(C)C[C@@H]4C)N4C[C@@H](C)N[C@@H](C)C4)ccc3c2=O)c(F)c1 |
| InChI | InChI=1S/C34H47FN6O3/c1-20-17-34(5,6)21(2)14-29(20)38-32(40-18-22(3)36-23(4)19-40)37-25-9-11-27-30(15-25)39-33(43)41(31(27)42)13-12-24-8-10-26(44-7)16-28(24)35/h8-11,15-16,20-23,29,36H,12-14,17-19H2,1-7H3,(H,37,38)(H,39,43)/t20-,21+,22-,23+,29-/m0/s1 |
| InChIKey | INFIAHMXQTYNJO-MQBQWNGFSA-N |
| XLogP | 4.99 |
| TPSA | 103.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.79 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|