About ethane;1-phenylhex-4-yn-3-one;sulfane
ethane;1-phenylhex-4-yn-3-one;sulfane (PubChem CID 143063569) has the molecular formula C16H26OS
and a molecular weight of 266.45 g/mol. Its IUPAC name is ethane;1-phenylhex-4-yn-3-one;sulfane.
Molecular Properties
| Compound Name | ethane;1-phenylhex-4-yn-3-one;sulfane |
| PubChem CID | 143063569 |
| Molecular Formula | C16H26OS |
| Molecular Weight | 266.45 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | ethane;1-phenylhex-4-yn-3-one;sulfane |
| SMILES | CC.CC.CC#CC(=O)CCc1ccccc1.S |
| InChI | InChI=1S/C12H12O.2C2H6.H2S/c1-2-6-12(13)10-9-11-7-4-3-5-8-11;2*1-2;/h3-5,7-8H,9-10H2,1H3;2*1-2H3;1H2 |
| InChIKey | SNCMXPKZPNFJLC-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.45 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-phenylhex-4-yn-3-one;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-phenylhex-4-yn-3-one;sulfane?
The IUPAC name of ethane;1-phenylhex-4-yn-3-one;sulfane (CID 143063569) is ethane;1-phenylhex-4-yn-3-one;sulfane.
What is the SMILES notation for ethane;1-phenylhex-4-yn-3-one;sulfane?
The canonical SMILES for ethane;1-phenylhex-4-yn-3-one;sulfane is CC.CC.CC#CC(=O)CCc1ccccc1.S.
What is the InChIKey of ethane;1-phenylhex-4-yn-3-one;sulfane?
The InChIKey is SNCMXPKZPNFJLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O.2C2H6.H2S/c1-2-6-12(13)10-9-11-7-4-3-5-8-11;2*1-2;/h3-5,7-8H,9-10H2,1H3;2*1-2H3;1H2.
What are the key properties of ethane;1-phenylhex-4-yn-3-one;sulfane?
ethane;1-phenylhex-4-yn-3-one;sulfane has a molecular weight of 266.45 g/mol, XLogP of 4.38, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-phenylhex-4-yn-3-one;sulfane is sourced from PubChem (CID 143063569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).