C9H14ClNO2 — CID 143067401
(E,3E)-4-chloro-3-(1-hydroxyethylidene)-N-methylhex-4-enamide (PubChem CID 143067401) has the molecular formula C9H14ClNO2 and a molecular weight of 203.67 g/mol. Its IUPAC name is (E,3E)-4-chloro-3-(1-hydroxyethylidene)-N-methylhex-4-enamide.
| Compound Name | (E,3E)-4-chloro-3-(1-hydroxyethylidene)-N-methylhex-4-enamide |
|---|---|
| PubChem CID | 143067401 |
| Molecular Formula | C9H14ClNO2 |
| Molecular Weight | 203.67 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | (E,3E)-4-chloro-3-(1-hydroxyethylidene)-N-methylhex-4-enamide |
| SMILES | C/C=C(Cl)\C(CC(=O)NC)=C(/C)O |
| InChI | InChI=1S/C9H14ClNO2/c1-4-8(10)7(6(2)12)5-9(13)11-3/h4,12H,5H2,1-3H3,(H,11,13)/b7-6+,8-4+ |
| InChIKey | NNQGHBBPJJALJC-CUXHJGIESA-N |
| XLogP | 2.10 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.67 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|