C21H29NOS — CID 143069977
(4aS,5S)-5-[(1E,3Z)-4-methylsulfanylpenta-1,3-dienyl]-9-propan-2-yl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline (PubChem CID 143069977) has the molecular formula C21H29NOS and a molecular weight of 343.54 g/mol. Its IUPAC name is (4aS,5S)-5-[(1E,3Z)-4-methylsulfanylpenta-1,3-dienyl]-9-propan-2-yl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline.
| Compound Name | (4aS,5S)-5-[(1E,3Z)-4-methylsulfanylpenta-1,3-dienyl]-9-propan-2-yl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
|---|---|
| PubChem CID | 143069977 |
| Molecular Formula | C21H29NOS |
| Molecular Weight | 343.54 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | (4aS,5S)-5-[(1E,3Z)-4-methylsulfanylpenta-1,3-dienyl]-9-propan-2-yl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
| SMILES | CS/C(C)=C\C=C\[C@@H]1Nc2ccc(C(C)C)cc2C2OCCC[C@H]21 |
| InChI | InChI=1S/C21H29NOS/c1-14(2)16-10-11-20-18(13-16)21-17(8-6-12-23-21)19(22-20)9-5-7-15(3)24-4/h5,7,9-11,13-14,17,19,21-22H,6,8,12H2,1-4H3/b9-5+,15-7-/t17-,19-,21?/m0/s1 |
| InChIKey | UJZCGYABOGCGEL-WDUWGUSVSA-N |
| XLogP | 5.89 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.54 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|