C9H14N4OS — CID 143084586
1-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-2H-tetrazole-5-thione;methanol (PubChem CID 143084586) has the molecular formula C9H14N4OS and a molecular weight of 226.31 g/mol. Its IUPAC name is 1-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-2H-tetrazole-5-thione;methanol.
| Compound Name | 1-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-2H-tetrazole-5-thione;methanol |
|---|---|
| PubChem CID | 143084586 |
| Molecular Formula | C9H14N4OS |
| Molecular Weight | 226.31 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 1-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-2H-tetrazole-5-thione;methanol |
| SMILES | C=C/C(=C\C=C/C)n1[nH]nnc1=S.CO |
| InChI | InChI=1S/C8H10N4S.CH4O/c1-3-5-6-7(4-2)12-8(13)9-10-11-12;1-2/h3-6H,2H2,1H3,(H,9,11,13);2H,1H3/b5-3-,7-6+; |
| InChIKey | LZDRHIHGTMJWDZ-GHVRSIOASA-N |
| XLogP | 1.55 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.31 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|