C28H41BClN3O5 — CID 143103065
tert-butyl N-[1-[[6-chloro-5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-3-pyridinyl]oxy]-3-(4-ethenyl-5-methyl-1H-pyrrol-3-yl)propan-2-yl]carbamate;prop-1-ene (PubChem CID 143103065) has the molecular formula C28H41BClN3O5 and a molecular weight of 545.92 g/mol. Its IUPAC name is tert-butyl N-[1-[[6-chloro-5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-3-pyridinyl]oxy]-3-(4-ethenyl-5-methyl-1H-pyrrol-3-yl)propan-2-yl]carbamate;prop-1-ene.
| Compound Name | tert-butyl N-[1-[[6-chloro-5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-3-pyridinyl]oxy]-3-(4-ethenyl-5-methyl-1H-pyrrol-3-yl)propan-2-yl]carbamate;prop-1-ene |
|---|---|
| PubChem CID | 143103065 |
| Molecular Formula | C28H41BClN3O5 |
| Molecular Weight | 545.92 g/mol |
| Exact Mass | 545.28 |
| IUPAC Name | tert-butyl N-[1-[[6-chloro-5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-3-pyridinyl]oxy]-3-(4-ethenyl-5-methyl-1H-pyrrol-3-yl)propan-2-yl]carbamate;prop-1-ene |
| SMILES | C=CC.C=Cc1c(CC(COc2cnc(Cl)c(B3OCC(C)(C)CO3)c2)NC(=O)OC(C)(C)C)c[nH]c1C |
| InChI | InChI=1S/C25H35BClN3O5.C3H6/c1-8-20-16(2)28-11-17(20)9-18(30-23(31)35-24(3,4)5)13-32-19-10-21(22(27)29-12-19)26-33-14-25(6,7)15-34-26;1-3-2/h8,10-12,18,28H,1,9,13-15H2,2-7H3,(H,30,31);3H,1H2,2H3 |
| InChIKey | SQKVWDDZYZEEHH-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 94.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.92 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|