C23H32ClNO3S — CID 143119824
4-[6-[(E)-4-chlorobut-3-en-2-yl]spiro[2.4]hept-5-en-5-yl]benzenesulfonamide;(E)-2-methoxypent-2-ene (PubChem CID 143119824) has the molecular formula C23H32ClNO3S and a molecular weight of 438.03 g/mol. Its IUPAC name is 4-[6-[(E)-4-chlorobut-3-en-2-yl]spiro[2.4]hept-5-en-5-yl]benzenesulfonamide;(E)-2-methoxypent-2-ene.
| Compound Name | 4-[6-[(E)-4-chlorobut-3-en-2-yl]spiro[2.4]hept-5-en-5-yl]benzenesulfonamide;(E)-2-methoxypent-2-ene |
|---|---|
| PubChem CID | 143119824 |
| Molecular Formula | C23H32ClNO3S |
| Molecular Weight | 438.03 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | 4-[6-[(E)-4-chlorobut-3-en-2-yl]spiro[2.4]hept-5-en-5-yl]benzenesulfonamide;(E)-2-methoxypent-2-ene |
| SMILES | CC(/C=C/Cl)C1=C(c2ccc(S(N)(=O)=O)cc2)CC2(CC2)C1.CC/C=C(\C)OC |
| InChI | InChI=1S/C17H20ClNO2S.C6H12O/c1-12(6-9-18)15-10-17(7-8-17)11-16(15)13-2-4-14(5-3-13)22(19,20)21;1-4-5-6(2)7-3/h2-6,9,12H,7-8,10-11H2,1H3,(H2,19,20,21);5H,4H2,1-3H3/b9-6+;6-5+ |
| InChIKey | RBQDAOLAGOLRBD-HVCMDKCQSA-N |
| XLogP | 6.00 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.03 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|