C27H36O — CID 143134326
[1-[(1E,3E,5Z)-4-[(2E)-2-ethylidene-4-methylpent-3-enoxy]hepta-1,3,5-trienyl]cyclohexyl]benzene (PubChem CID 143134326) has the molecular formula C27H36O and a molecular weight of 376.58 g/mol. Its IUPAC name is [1-[(1E,3E,5Z)-4-[(2E)-2-ethylidene-4-methylpent-3-enoxy]hepta-1,3,5-trienyl]cyclohexyl]benzene.
| Compound Name | [1-[(1E,3E,5Z)-4-[(2E)-2-ethylidene-4-methylpent-3-enoxy]hepta-1,3,5-trienyl]cyclohexyl]benzene |
|---|---|
| PubChem CID | 143134326 |
| Molecular Formula | C27H36O |
| Molecular Weight | 376.58 g/mol |
| Exact Mass | 376.28 |
| IUPAC Name | [1-[(1E,3E,5Z)-4-[(2E)-2-ethylidene-4-methylpent-3-enoxy]hepta-1,3,5-trienyl]cyclohexyl]benzene |
| SMILES | C/C=C\C(=C/C=C/C1(c2ccccc2)CCCCC1)OC/C(C=C(C)C)=C/C |
| InChI | InChI=1S/C27H36O/c1-5-14-26(28-22-24(6-2)21-23(3)4)17-13-20-27(18-11-8-12-19-27)25-15-9-7-10-16-25/h5-7,9-10,13-17,20-21H,8,11-12,18-19,22H2,1-4H3/b14-5-,20-13+,24-6+,26-17+ |
| InChIKey | ZLWMUNVPMXEMFR-JHXCJKFNSA-N |
| XLogP | 7.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.58 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|