C16H21N3O2 — CID 143136736
2-amino-4-butoxyphenol;7,8-diazabicyclo[4.2.0]octa-1,3,5-triene (PubChem CID 143136736) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 2-amino-4-butoxyphenol;7,8-diazabicyclo[4.2.0]octa-1,3,5-triene.
| Compound Name | 2-amino-4-butoxyphenol;7,8-diazabicyclo[4.2.0]octa-1,3,5-triene |
|---|---|
| PubChem CID | 143136736 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 2-amino-4-butoxyphenol;7,8-diazabicyclo[4.2.0]octa-1,3,5-triene |
| SMILES | CCCCOc1ccc(O)c(N)c1.c1ccc2[nH][nH]c2c1 |
| InChI | InChI=1S/C10H15NO2.C6H6N2/c1-2-3-6-13-8-4-5-10(12)9(11)7-8;1-2-4-6-5(3-1)7-8-6/h4-5,7,12H,2-3,6,11H2,1H3;1-4,7-8H |
| InChIKey | JAPFMAGXCSIKAI-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 87.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|