C21H26N4OS — CID 143160008
N-[2-formyl-4-[methyl(prop-2-enyl)amino]thieno[2,3-b]pyridin-3-yl]-N'-[(2Z,4Z)-4-methylhepta-2,4-dienyl]methanimidamide (PubChem CID 143160008) has the molecular formula C21H26N4OS and a molecular weight of 382.53 g/mol. Its IUPAC name is N-[2-formyl-4-[methyl(prop-2-enyl)amino]thieno[2,3-b]pyridin-3-yl]-N'-[(2Z,4Z)-4-methylhepta-2,4-dienyl]methanimidamide.
| Compound Name | N-[2-formyl-4-[methyl(prop-2-enyl)amino]thieno[2,3-b]pyridin-3-yl]-N'-[(2Z,4Z)-4-methylhepta-2,4-dienyl]methanimidamide |
|---|---|
| PubChem CID | 143160008 |
| Molecular Formula | C21H26N4OS |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | N-[2-formyl-4-[methyl(prop-2-enyl)amino]thieno[2,3-b]pyridin-3-yl]-N'-[(2Z,4Z)-4-methylhepta-2,4-dienyl]methanimidamide |
| SMILES | C=CCN(C)c1ccnc2sc(C=O)c(N/C=N/C/C=C\C(C)=C/CC)c12 |
| InChI | InChI=1S/C21H26N4OS/c1-5-8-16(3)9-7-11-22-15-24-20-18(14-26)27-21-19(20)17(10-12-23-21)25(4)13-6-2/h6-10,12,14-15H,2,5,11,13H2,1,3-4H3,(H,22,24)/b9-7-,16-8- |
| InChIKey | OJBKVZCEQMLPLU-BIHOSGGPSA-N |
| XLogP | 5.08 |
| TPSA | 57.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|